5-(Aminomethyl)indole
Catalog No: FT-0661923
CAS No: 81881-74-5
- Chemical Name: 5-(Aminomethyl)indole
- Molecular Formula: C9H10N2
- Molecular Weight: 146.19
- InChI Key: UAYYSAPJTRVEQA-UHFFFAOYSA-N
- InChI: InChI=1S/C9H10N2/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-5,11H,6,10H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1-(1H-indol-5-yl)methanamine |
|---|---|
| Bolling_Point: | 335.6ºC at 760 mmHg |
| MF: | C11H12N2O4 |
| Symbol: | GHS07 |
| Melting_Point: | 114-118ºC |
| CAS: | 81881-74-5 |
| Density: | 1.199 g/cm3 |
| FW: | 236.224 |
| Flash_Point: | 183.3ºC |
| Exact_Mass: | 236.079712 |
|---|---|
| Refractive_Index: | 1.697 |
| LogP: | 2.32690 |
| Bolling_Point: | 335.6ºC at 760 mmHg |
| Density: | 1.199 g/cm3 |
| MF: | C11H12N2O4 |
| PSA: | 41.81000 |
| FW: | 236.224 |
| Flash_Point: | 183.3ºC |
| Melting_Point: | 114-118ºC |
| Risk_Statements(EU): | R22 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard_Codes: | Xn: Harmful; |
| RTECS: | NL4461500 |
| HS_Code: | 2933990090 |
| Safety_Statements: | 26-36 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)